C21H27ClN8O4 — CID 57406777
1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-chlorophenyl)urea (PubChem CID 57406777) has the molecular formula C21H27ClN8O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 57406777 |
| Molecular Formula | C21H27ClN8O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-chlorophenyl)urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(Cl)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H27ClN8O4/c1-29(8-2-7-24-21(33)28-13-5-3-12(22)4-6-13)9-14-16(31)17(32)20(34-14)30-11-27-15-18(23)25-10-26-19(15)30/h3-6,10-11,14,16-17,20,31-32H,2,7-9H2,1H3,(H2,23,25,26)(H2,24,28,33)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | NCAWHWMUFFKTIY-WVSUBDOOSA-N |
| XLogP | 0.82 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|