C19H23BrN8O3S — CID 177379624
2-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]ethyl]-1-(2-bromophenyl)guanidine (PubChem CID 177379624) has the molecular formula C19H23BrN8O3S and a molecular weight of 523.42 g/mol. Its IUPAC name is 2-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]ethyl]-1-(2-bromophenyl)guanidine.
| Compound Name | 2-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]ethyl]-1-(2-bromophenyl)guanidine |
|---|---|
| PubChem CID | 177379624 |
| Molecular Formula | C19H23BrN8O3S |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 2-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]ethyl]-1-(2-bromophenyl)guanidine |
| SMILES | N/C(=N\CCSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)Nc1ccccc1Br |
| InChI | InChI=1S/C19H23BrN8O3S/c20-10-3-1-2-4-11(10)27-19(22)23-5-6-32-7-12-14(29)15(30)18(31-12)28-9-26-13-16(21)24-8-25-17(13)28/h1-4,8-9,12,14-15,18,29-30H,5-7H2,(H2,21,24,25)(H3,22,23,27)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | DVZZYZNFLHFCPI-SCFUHWHPSA-N |
| XLogP | 0.95 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|