C14H18ClN7O6 — CID 89212254
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]butanoic acid (PubChem CID 89212254) has the molecular formula C14H18ClN7O6 and a molecular weight of 415.79 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 89212254 |
| Molecular Formula | C14H18ClN7O6 |
| Molecular Weight | 415.79 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]butanoic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](C(=O)NCC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18ClN7O6/c15-14-20-9(17)5-10(21-14)22(3-19-5)12-7(24)6(23)8(28-12)11(25)18-2-1-4(16)13(26)27/h3-4,6-8,12,23-24H,1-2,16H2,(H,18,25)(H,26,27)(H2,17,20,21)/t4-,6-,7+,8-,12+/m0/s1 |
| InChIKey | PXJRBUGRZPXNSA-GSWHQLRPSA-N |
| XLogP | -2.40 |
| TPSA | 211.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.79 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |