C10H11Cl2N5O3 — CID 89189091
(2R,4S,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol (PubChem CID 89189091) has the molecular formula C10H11Cl2N5O3 and a molecular weight of 320.14 g/mol. Its IUPAC name is (2R,4S,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol.
| Compound Name | (2R,4S,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 89189091 |
| Molecular Formula | C10H11Cl2N5O3 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (2R,4S,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CCl)[C@@H](O)C1O |
| InChI | InChI=1S/C10H11Cl2N5O3/c11-1-3-5(18)6(19)9(20-3)17-2-14-4-7(13)15-10(12)16-8(4)17/h2-3,5-6,9,18-19H,1H2,(H2,13,15,16)/t3-,5-,6?,9-/m1/s1 |
| InChIKey | SLVRPUYTSVRHEI-BMWIRTBBSA-N |
| XLogP | -0.08 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|