C10H12ClN5O3 — CID 87672546
(2R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-methyloxolane-3,4-diol (PubChem CID 87672546) has the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. Its IUPAC name is (2R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-methyloxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 87672546 |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)C(O)C1O |
| InChI | InChI=1S/C10H12ClN5O3/c1-3-5(17)6(18)9(19-3)16-2-13-4-7(12)14-10(11)15-8(4)16/h2-3,5-6,9,17-18H,1H3,(H2,12,14,15)/t3-,5?,6?,9-/m1/s1 |
| InChIKey | DFMMRUDEZILQOP-VKJDSPIKSA-N |
| XLogP | -0.30 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |