C13H17ClN6O4 — CID 123164013
4-[(2R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]butanamide (PubChem CID 123164013) has the molecular formula C13H17ClN6O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is 4-[(2R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]butanamide.
| Compound Name | 4-[(2R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]butanamide |
|---|---|
| PubChem CID | 123164013 |
| Molecular Formula | C13H17ClN6O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-[(2R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]butanamide |
| SMILES | NC(=O)CCC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)C(O)C1O |
| InChI | InChI=1S/C13H17ClN6O4/c14-13-18-10(16)7-11(19-13)20(4-17-7)12-9(23)8(22)5(24-12)2-1-3-6(15)21/h4-5,8-9,12,22-23H,1-3H2,(H2,15,21)(H2,16,18,19)/t5-,8?,9?,12-/m1/s1 |
| InChIKey | ZEZIJMFDSKTJNC-UHPBWSRCSA-N |
| XLogP | -0.66 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |