C26H27ClN6O4 — CID 44593190
(2S,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-N-(3,3-diphenylpropyl)-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 44593190) has the molecular formula C26H27ClN6O4 and a molecular weight of 522.99 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-N-(3,3-diphenylpropyl)-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-N-(3,3-diphenylpropyl)-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 44593190 |
| Molecular Formula | C26H27ClN6O4 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-N-(3,3-diphenylpropyl)-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](C(=O)NCCC(c2ccccc2)c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H27ClN6O4/c1-28-22-18-23(32-26(27)31-22)33(14-30-18)25-20(35)19(34)21(37-25)24(36)29-13-12-17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17,19-21,25,34-35H,12-13H2,1H3,(H,29,36)(H,28,31,32)/t19-,20+,21-,25+/m0/s1 |
| InChIKey | YIUMXCAOZSZPMP-UGCAPWQASA-N |
| XLogP | 2.48 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |