C28H40N8O3S — CID 172576899
1-cyclopentyl-2-[3-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]propyl]guanidine (PubChem CID 172576899) has the molecular formula C28H40N8O3S and a molecular weight of 568.75 g/mol. Its IUPAC name is 1-cyclopentyl-2-[3-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]propyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[3-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]propyl]guanidine |
|---|---|
| PubChem CID | 172576899 |
| Molecular Formula | C28H40N8O3S |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 1-cyclopentyl-2-[3-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]propyl]guanidine |
| SMILES | N/C(=N\CCCSC[C@H]1O[C@@H](n2cnc3c(NCCCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O)NC1CCCC1 |
| InChI | InChI=1S/C28H40N8O3S/c29-28(35-20-11-4-5-12-20)31-14-7-15-40-16-21-23(37)24(38)27(39-21)36-18-34-22-25(32-17-33-26(22)36)30-13-6-10-19-8-2-1-3-9-19/h1-3,8-9,17-18,20-21,23-24,27,37-38H,4-7,10-16H2,(H3,29,31,35)(H,30,32,33)/t21-,23-,24-,27-/m1/s1 |
| InChIKey | FWYGUVBVJIFKEK-VBHAUSMQSA-N |
| XLogP | 2.46 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|