C25H25Cl2N5O2 — CID 11340966
2-chloro-N-[2-[[4-(2-chloroethoxy)phenyl]methoxy]phenyl]-9-cyclopentylpurin-6-amine (PubChem CID 11340966) has the molecular formula C25H25Cl2N5O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-(2-chloroethoxy)phenyl]methoxy]phenyl]-9-cyclopentylpurin-6-amine.
| Compound Name | 2-chloro-N-[2-[[4-(2-chloroethoxy)phenyl]methoxy]phenyl]-9-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 11340966 |
| Molecular Formula | C25H25Cl2N5O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 2-chloro-N-[2-[[4-(2-chloroethoxy)phenyl]methoxy]phenyl]-9-cyclopentylpurin-6-amine |
| SMILES | ClCCOc1ccc(COc2ccccc2Nc2nc(Cl)nc3c2ncn3C2CCCC2)cc1 |
| InChI | InChI=1S/C25H25Cl2N5O2/c26-13-14-33-19-11-9-17(10-12-19)15-34-21-8-4-3-7-20(21)29-23-22-24(31-25(27)30-23)32(16-28-22)18-5-1-2-6-18/h3-4,7-12,16,18H,1-2,5-6,13-15H2,(H,29,30,31) |
| InChIKey | ZCVDLAXICTYWBS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|