C16H16BrClN6 — CID 90332878
N-[(6-bromo-3-pyridinyl)methyl]-2-chloro-9-cyclopentylpurin-6-amine (PubChem CID 90332878) has the molecular formula C16H16BrClN6 and a molecular weight of 407.70 g/mol. Its IUPAC name is N-[(6-bromo-3-pyridinyl)methyl]-2-chloro-9-cyclopentylpurin-6-amine.
| Compound Name | N-[(6-bromo-3-pyridinyl)methyl]-2-chloro-9-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 90332878 |
| Molecular Formula | C16H16BrClN6 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | N-[(6-bromo-3-pyridinyl)methyl]-2-chloro-9-cyclopentylpurin-6-amine |
| SMILES | Clc1nc(NCc2ccc(Br)nc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C16H16BrClN6/c17-12-6-5-10(7-19-12)8-20-14-13-15(23-16(18)22-14)24(9-21-13)11-3-1-2-4-11/h5-7,9,11H,1-4,8H2,(H,20,22,23) |
| InChIKey | NNSFYJBLBQTQOI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|