C25H28FN7O — CID 118589979
3-[[9-cyclopentyl-6-[[6-(3-fluorophenyl)-3-pyridinyl]methylamino]purin-2-yl]amino]propan-1-ol (PubChem CID 118589979) has the molecular formula C25H28FN7O and a molecular weight of 461.55 g/mol. Its IUPAC name is 3-[[9-cyclopentyl-6-[[6-(3-fluorophenyl)-3-pyridinyl]methylamino]purin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[9-cyclopentyl-6-[[6-(3-fluorophenyl)-3-pyridinyl]methylamino]purin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 118589979 |
| Molecular Formula | C25H28FN7O |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[[9-cyclopentyl-6-[[6-(3-fluorophenyl)-3-pyridinyl]methylamino]purin-2-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc(NCc2ccc(-c3cccc(F)c3)nc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C25H28FN7O/c26-19-6-3-5-18(13-19)21-10-9-17(14-28-21)15-29-23-22-24(32-25(31-23)27-11-4-12-34)33(16-30-22)20-7-1-2-8-20/h3,5-6,9-10,13-14,16,20,34H,1-2,4,7-8,11-12,15H2,(H2,27,29,31,32) |
| InChIKey | UIPMNQKCLKQQMZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|