C25H31N7O2 — CID 129068397
3-[[9-cyclopentyl-6-[[6-(furan-3-yl)-3-pyridinyl]methylamino]purin-2-yl]amino]pentan-2-ol (PubChem CID 129068397) has the molecular formula C25H31N7O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 3-[[9-cyclopentyl-6-[[6-(furan-3-yl)-3-pyridinyl]methylamino]purin-2-yl]amino]pentan-2-ol.
| Compound Name | 3-[[9-cyclopentyl-6-[[6-(furan-3-yl)-3-pyridinyl]methylamino]purin-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 129068397 |
| Molecular Formula | C25H31N7O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 3-[[9-cyclopentyl-6-[[6-(furan-3-yl)-3-pyridinyl]methylamino]purin-2-yl]amino]pentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2ccc(-c3ccoc3)nc2)c2ncn(C3CCCC3)c2n1)C(C)O |
| InChI | InChI=1S/C25H31N7O2/c1-3-20(16(2)33)29-25-30-23(22-24(31-25)32(15-28-22)19-6-4-5-7-19)27-13-17-8-9-21(26-12-17)18-10-11-34-14-18/h8-12,14-16,19-20,33H,3-7,13H2,1-2H3,(H2,27,29,30,31) |
| InChIKey | OOIVRRPEKANGFA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |