C23H32IN7O — CID 67002024
3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]pentan-2-ol (PubChem CID 67002024) has the molecular formula C23H32IN7O and a molecular weight of 549.46 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]pentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 67002024 |
| Molecular Formula | C23H32IN7O |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]pentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(I)ccc2N)c2ncn(C3CCCCC3)c2n1)C(C)O |
| InChI | InChI=1S/C23H32IN7O/c1-3-19(14(2)32)28-23-29-21(26-12-15-11-16(24)9-10-18(15)25)20-22(30-23)31(13-27-20)17-7-5-4-6-8-17/h9-11,13-14,17,19,32H,3-8,12,25H2,1-2H3,(H2,26,28,29,30) |
| InChIKey | UOJWRNBGGBNJSS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|