C23H33N7O2 — CID 46927644
2-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]butan-1-ol (PubChem CID 46927644) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]butan-1-ol.
| Compound Name | 2-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 46927644 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(NCc2cc(OC)ccc2N)c2ncn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C23H33N7O2/c1-3-16(13-31)27-23-28-21(25-12-15-11-18(32-2)9-10-19(15)24)20-22(29-23)30(14-26-20)17-7-5-4-6-8-17/h9-11,14,16-17,31H,3-8,12-13,24H2,1-2H3,(H2,25,27,28,29) |
| InChIKey | IKMZRFKFICDCAL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|