C23H32ClN7O — CID 67002926
2-[[6-[(2-amino-3-chlorophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]-3-methylbutan-1-ol (PubChem CID 67002926) has the molecular formula C23H32ClN7O and a molecular weight of 458.01 g/mol. Its IUPAC name is 2-[[6-[(2-amino-3-chlorophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]-3-methylbutan-1-ol.
| Compound Name | 2-[[6-[(2-amino-3-chlorophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 67002926 |
| Molecular Formula | C23H32ClN7O |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 2-[[6-[(2-amino-3-chlorophenyl)methylamino]-9-cyclohexylpurin-2-yl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)Nc1nc(NCc2cccc(Cl)c2N)c2ncn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C23H32ClN7O/c1-14(2)18(12-32)28-23-29-21(26-11-15-7-6-10-17(24)19(15)25)20-22(30-23)31(13-27-20)16-8-4-3-5-9-16/h6-7,10,13-14,16,18,32H,3-5,8-9,11-12,25H2,1-2H3,(H2,26,28,29,30) |
| InChIKey | ZIFBTIANOJCICD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|