C18H24N6O2 — CID 21039974
(2R)-2-[[9-ethyl-6-(3-methoxyanilino)purin-2-yl]amino]butan-1-ol (PubChem CID 21039974) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (2R)-2-[[9-ethyl-6-(3-methoxyanilino)purin-2-yl]amino]butan-1-ol.
| Compound Name | (2R)-2-[[9-ethyl-6-(3-methoxyanilino)purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 21039974 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (2R)-2-[[9-ethyl-6-(3-methoxyanilino)purin-2-yl]amino]butan-1-ol |
| SMILES | CC[C@H](CO)Nc1nc(Nc2cccc(OC)c2)c2ncn(CC)c2n1 |
| InChI | InChI=1S/C18H24N6O2/c1-4-12(10-25)21-18-22-16(15-17(23-18)24(5-2)11-19-15)20-13-7-6-8-14(9-13)26-3/h6-9,11-12,25H,4-5,10H2,1-3H3,(H2,20,21,22,23)/t12-/m1/s1 |
| InChIKey | UUHWYUVOPCYSOQ-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |