C25H26N8O — CID 23917732
3-[[9-ethyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]purin-6-yl]amino]benzonitrile (PubChem CID 23917732) has the molecular formula C25H26N8O and a molecular weight of 454.54 g/mol. Its IUPAC name is 3-[[9-ethyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]purin-6-yl]amino]benzonitrile.
| Compound Name | 3-[[9-ethyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]purin-6-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 23917732 |
| Molecular Formula | C25H26N8O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 3-[[9-ethyl-2-[4-(4-methoxyphenyl)piperazin-1-yl]purin-6-yl]amino]benzonitrile |
| SMILES | CCn1cnc2c(Nc3cccc(C#N)c3)nc(N3CCN(c4ccc(OC)cc4)CC3)nc21 |
| InChI | InChI=1S/C25H26N8O/c1-3-31-17-27-22-23(28-19-6-4-5-18(15-19)16-26)29-25(30-24(22)31)33-13-11-32(12-14-33)20-7-9-21(34-2)10-8-20/h4-10,15,17H,3,11-14H2,1-2H3,(H,28,29,30) |
| InChIKey | PNKSLWYJAHOIJT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|