C29H25F3N6O2 — CID 117086323
2-morpholin-4-yl-N-(4-phenoxyphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117086323) has the molecular formula C29H25F3N6O2 and a molecular weight of 546.55 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(4-phenoxyphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-morpholin-4-yl-N-(4-phenoxyphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117086323 |
| Molecular Formula | C29H25F3N6O2 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 2-morpholin-4-yl-N-(4-phenoxyphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(Nc4ccc(Oc5ccccc5)cc4)nc(N4CCOCC4)nc32)cc1 |
| InChI | InChI=1S/C29H25F3N6O2/c30-29(31,32)21-8-6-20(7-9-21)18-38-19-33-25-26(35-28(36-27(25)38)37-14-16-39-17-15-37)34-22-10-12-24(13-11-22)40-23-4-2-1-3-5-23/h1-13,19H,14-18H2,(H,34,35,36) |
| InChIKey | NKFYDZMRIUVCAB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |