C24H28F3N7O2 — CID 117082932
1-[3-[[2-morpholin-4-yl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117082932) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 1-[3-[[2-morpholin-4-yl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-morpholin-4-yl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117082932 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 1-[3-[[2-morpholin-4-yl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1nc(N2CCOCC2)nc2c1ncn2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28F3N7O2/c25-24(26,27)18-6-4-17(5-7-18)15-34-16-29-20-21(28-8-2-10-32-9-1-3-19(32)35)30-23(31-22(20)34)33-11-13-36-14-12-33/h4-7,16H,1-3,8-15H2,(H,28,30,31) |
| InChIKey | GWJRQPWAXWYIJU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|