C30H25F6N7O — CID 117079961
6-N-(4-morpholin-4-ylphenyl)-2-N-[4-(trifluoromethyl)phenyl]-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine (PubChem CID 117079961) has the molecular formula C30H25F6N7O and a molecular weight of 613.57 g/mol. Its IUPAC name is 6-N-(4-morpholin-4-ylphenyl)-2-N-[4-(trifluoromethyl)phenyl]-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine.
| Compound Name | 6-N-(4-morpholin-4-ylphenyl)-2-N-[4-(trifluoromethyl)phenyl]-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 117079961 |
| Molecular Formula | C30H25F6N7O |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | 6-N-(4-morpholin-4-ylphenyl)-2-N-[4-(trifluoromethyl)phenyl]-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(Nc4ccc(N5CCOCC5)cc4)nc(Nc4ccc(C(F)(F)F)cc4)nc32)cc1 |
| InChI | InChI=1S/C30H25F6N7O/c31-29(32,33)20-3-1-19(2-4-20)17-43-18-37-25-26(38-22-9-11-24(12-10-22)42-13-15-44-16-14-42)40-28(41-27(25)43)39-23-7-5-21(6-8-23)30(34,35)36/h1-12,18H,13-17H2,(H2,38,39,40,41) |
| InChIKey | BZPNLCJXANCGAZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|