C21H19F3N6O — CID 117082595
2-[[2-anilino-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethanol (PubChem CID 117082595) has the molecular formula C21H19F3N6O and a molecular weight of 428.42 g/mol. Its IUPAC name is 2-[[2-anilino-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethanol.
| Compound Name | 2-[[2-anilino-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 117082595 |
| Molecular Formula | C21H19F3N6O |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[[2-anilino-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethanol |
| SMILES | OCCNc1nc(Nc2ccccc2)nc2c1ncn2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N6O/c22-21(23,24)15-8-6-14(7-9-15)12-30-13-26-17-18(25-10-11-31)28-20(29-19(17)30)27-16-4-2-1-3-5-16/h1-9,13,31H,10-12H2,(H2,25,27,28,29) |
| InChIKey | WOMOESQSCCNFHP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |