C27H29F3N6O2 — CID 117084473
4-[[6-(2-phenoxyethylamino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 117084473) has the molecular formula C27H29F3N6O2 and a molecular weight of 526.56 g/mol. Its IUPAC name is 4-[[6-(2-phenoxyethylamino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-(2-phenoxyethylamino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 117084473 |
| Molecular Formula | C27H29F3N6O2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 4-[[6-(2-phenoxyethylamino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2nc(NCCOc3ccccc3)c3ncn(Cc4ccc(C(F)(F)F)cc4)c3n2)CC1 |
| InChI | InChI=1S/C27H29F3N6O2/c28-27(29,30)19-8-6-18(7-9-19)16-36-17-32-23-24(31-14-15-38-22-4-2-1-3-5-22)34-26(35-25(23)36)33-20-10-12-21(37)13-11-20/h1-9,17,20-21,37H,10-16H2,(H2,31,33,34,35) |
| InChIKey | DWJZNJFVFBNMJA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|