C30H25F3N6O — CID 117090278
2-(1-methylindol-5-yl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117090278) has the molecular formula C30H25F3N6O and a molecular weight of 542.57 g/mol. Its IUPAC name is 2-(1-methylindol-5-yl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-(1-methylindol-5-yl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117090278 |
| Molecular Formula | C30H25F3N6O |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 2-(1-methylindol-5-yl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | Cn1ccc2cc(-c3nc(NCCOc4ccccc4)c4ncn(Cc5ccc(C(F)(F)F)cc5)c4n3)ccc21 |
| InChI | InChI=1S/C30H25F3N6O/c1-38-15-13-21-17-22(9-12-25(21)38)27-36-28(34-14-16-40-24-5-3-2-4-6-24)26-29(37-27)39(19-35-26)18-20-7-10-23(11-8-20)30(31,32)33/h2-13,15,17,19H,14,16,18H2,1H3,(H,34,36,37) |
| InChIKey | CMUYVVMZACZQMI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|