C27H23F3N6O — CID 117083893
4-[2-[[2-(3-aminophenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethyl]phenol (PubChem CID 117083893) has the molecular formula C27H23F3N6O and a molecular weight of 504.52 g/mol. Its IUPAC name is 4-[2-[[2-(3-aminophenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(3-aminophenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117083893 |
| Molecular Formula | C27H23F3N6O |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-[2-[[2-(3-aminophenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]ethyl]phenol |
| SMILES | Nc1cccc(-c2nc(NCCc3ccc(O)cc3)c3ncn(Cc4ccc(C(F)(F)F)cc4)c3n2)c1 |
| InChI | InChI=1S/C27H23F3N6O/c28-27(29,30)20-8-4-18(5-9-20)15-36-16-33-23-25(32-13-12-17-6-10-22(37)11-7-17)34-24(35-26(23)36)19-2-1-3-21(31)14-19/h1-11,14,16,37H,12-13,15,31H2,(H,32,34,35) |
| InChIKey | STJKJEHQJJYSSW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|