C24H22N6OS — CID 117083110
2-(3-aminophenyl)-N-[2-(4-methoxyphenyl)ethyl]-9-thiophen-3-ylpurin-6-amine (PubChem CID 117083110) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-[2-(4-methoxyphenyl)ethyl]-9-thiophen-3-ylpurin-6-amine.
| Compound Name | 2-(3-aminophenyl)-N-[2-(4-methoxyphenyl)ethyl]-9-thiophen-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 117083110 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(3-aminophenyl)-N-[2-(4-methoxyphenyl)ethyl]-9-thiophen-3-ylpurin-6-amine |
| SMILES | COc1ccc(CCNc2nc(-c3cccc(N)c3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C24H22N6OS/c1-31-20-7-5-16(6-8-20)9-11-26-23-21-24(30(15-27-21)19-10-12-32-14-19)29-22(28-23)17-3-2-4-18(25)13-17/h2-8,10,12-15H,9,11,25H2,1H3,(H,26,28,29) |
| InChIKey | ROTQWGLUTIHOAW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|