C25H19F3N6 — CID 117092309
2-(3-aminophenyl)-9-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117092309) has the molecular formula C25H19F3N6 and a molecular weight of 460.46 g/mol. Its IUPAC name is 2-(3-aminophenyl)-9-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-(3-aminophenyl)-9-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117092309 |
| Molecular Formula | C25H19F3N6 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-(3-aminophenyl)-9-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | Nc1cccc(-c2nc(NCc3cccc(C(F)(F)F)c3)c3ncn(-c4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C25H19F3N6/c26-25(27,28)18-8-4-6-16(12-18)14-30-23-21-24(34(15-31-21)20-10-2-1-3-11-20)33-22(32-23)17-7-5-9-19(29)13-17/h1-13,15H,14,29H2,(H,30,32,33) |
| InChIKey | DIDFKAYKACSDHO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|