C24H21N5O2S — CID 117084437
4-[2-[[2-(4-methoxyphenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol (PubChem CID 117084437) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-[2-[[2-(4-methoxyphenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(4-methoxyphenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117084437 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-[2-[[2-(4-methoxyphenyl)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol |
| SMILES | COc1ccc(-c2nc(NCCc3ccc(O)cc3)c3ncn(-c4ccsc4)c3n2)cc1 |
| InChI | InChI=1S/C24H21N5O2S/c1-31-20-8-4-17(5-9-20)22-27-23(25-12-10-16-2-6-19(30)7-3-16)21-24(28-22)29(15-26-21)18-11-13-32-14-18/h2-9,11,13-15,30H,10,12H2,1H3,(H,25,27,28) |
| InChIKey | PVGFLBUZXQRSCU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |