C31H29F3N8O2 — CID 117080718
N-[4-[[2-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]phenyl]acetamide (PubChem CID 117080718) has the molecular formula C31H29F3N8O2 and a molecular weight of 602.62 g/mol. Its IUPAC name is N-[4-[[2-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117080718 |
| Molecular Formula | C31H29F3N8O2 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | N-[4-[[2-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Nc3ccc(N4CCOCC4)cc3)nc3c2ncn3Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H29F3N8O2/c1-20(43)36-23-6-8-24(9-7-23)37-28-27-29(42(19-35-27)18-21-2-4-22(5-3-21)31(32,33)34)40-30(39-28)38-25-10-12-26(13-11-25)41-14-16-44-17-15-41/h2-13,19H,14-18H2,1H3,(H,36,43)(H2,37,38,39,40) |
| InChIKey | LFPZUURPBBOQLA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|