C29H29F3N8O — CID 117080531
N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine (PubChem CID 117080531) has the molecular formula C29H29F3N8O and a molecular weight of 562.60 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine |
|---|---|
| PubChem CID | 117080531 |
| Molecular Formula | C29H29F3N8O |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine |
| SMILES | Cc1nn(C)c(C)c1-c1nc(Nc2ccc(N3CCOCC3)cc2)c2ncn(Cc3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C29H29F3N8O/c1-18-24(19(2)38(3)37-18)26-35-27(34-22-8-10-23(11-9-22)39-12-14-41-15-13-39)25-28(36-26)40(17-33-25)16-20-4-6-21(7-5-20)29(30,31)32/h4-11,17H,12-16H2,1-3H3,(H,34,35,36) |
| InChIKey | XVVLVAADMXSWKX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|