C29H27F3N8O — CID 117090870
6-N-(4-morpholin-4-ylphenyl)-2-N-(pyridin-3-ylmethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine (PubChem CID 117090870) has the molecular formula C29H27F3N8O and a molecular weight of 560.58 g/mol. Its IUPAC name is 6-N-(4-morpholin-4-ylphenyl)-2-N-(pyridin-3-ylmethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine.
| Compound Name | 6-N-(4-morpholin-4-ylphenyl)-2-N-(pyridin-3-ylmethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 117090870 |
| Molecular Formula | C29H27F3N8O |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 6-N-(4-morpholin-4-ylphenyl)-2-N-(pyridin-3-ylmethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(Nc4ccc(N5CCOCC5)cc4)nc(NCc4cccnc4)nc32)cc1 |
| InChI | InChI=1S/C29H27F3N8O/c30-29(31,32)22-5-3-20(4-6-22)18-40-19-35-25-26(36-23-7-9-24(10-8-23)39-12-14-41-15-13-39)37-28(38-27(25)40)34-17-21-2-1-11-33-16-21/h1-11,16,19H,12-15,17-18H2,(H2,34,36,37,38) |
| InChIKey | XJSURMDRXHMVDD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|