C22H23N7 — CID 112866956
3-[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112866956) has the molecular formula C22H23N7 and a molecular weight of 385.48 g/mol. Its IUPAC name is 3-[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112866956 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CN1CCN(c2ccc(Nc3cc(Nc4cccc(C#N)c4)ncn3)cc2)CC1 |
| InChI | InChI=1S/C22H23N7/c1-28-9-11-29(12-10-28)20-7-5-18(6-8-20)26-21-14-22(25-16-24-21)27-19-4-2-3-17(13-19)15-23/h2-8,13-14,16H,9-12H2,1H3,(H2,24,25,26,27) |
| InChIKey | HRENHQGVXHVUDY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|