C23H25N7 — CID 112931834
3-[[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 112931834) has the molecular formula C23H25N7 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-[[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 3-[[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112931834 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(Nc2ccc(N3CCN(C)CC3)cc2)nc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C23H25N7/c1-17-14-22(28-23(25-17)27-20-5-3-4-18(15-20)16-24)26-19-6-8-21(9-7-19)30-12-10-29(2)11-13-30/h3-9,14-15H,10-13H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | GLOFUXBKBOGFCK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|