C23H26N8 — CID 156704704
4-N-(1H-indazol-6-yl)-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 156704704) has the molecular formula C23H26N8 and a molecular weight of 414.52 g/mol. Its IUPAC name is 4-N-(1H-indazol-6-yl)-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-6-yl)-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 156704704 |
| Molecular Formula | C23H26N8 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 4-N-(1H-indazol-6-yl)-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc3cn[nH]c3c2)nc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C23H26N8/c1-16-13-22(26-19-4-3-17-15-24-29-21(17)14-19)28-23(25-16)27-18-5-7-20(8-6-18)31-11-9-30(2)10-12-31/h3-8,13-15H,9-12H2,1-2H3,(H,24,29)(H2,25,26,27,28) |
| InChIKey | NXJZGPPFABBYOE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|