C22H27N7 — CID 112919680
6-methyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112919680) has the molecular formula C22H27N7 and a molecular weight of 389.51 g/mol. Its IUPAC name is 6-methyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112919680 |
| Molecular Formula | C22H27N7 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 6-methyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N3CCN(C)CC3)cc2)nc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C22H27N7/c1-17-14-21(27-22(25-17)24-16-18-4-3-9-23-15-18)26-19-5-7-20(8-6-19)29-12-10-28(2)11-13-29/h3-9,14-15H,10-13,16H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | ZURKYHWYJROYAA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|