C23H28N6 — CID 112919678
6-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112919678) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 6-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112919678 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 6-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N3CCC(C)CC3)cc2)nc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C23H28N6/c1-17-9-12-29(13-10-17)21-7-5-20(6-8-21)27-22-14-18(2)26-23(28-22)25-16-19-4-3-11-24-15-19/h3-8,11,14-15,17H,9-10,12-13,16H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | JNYZRCRZYIQOTI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|