C20H30N6 — CID 112924707
4-N-tert-butyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 112924707) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-N-tert-butyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-tert-butyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112924707 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 4-N-tert-butyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC(C)(C)C)nc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C20H30N6/c1-15-14-18(24-20(2,3)4)23-19(21-15)22-16-6-8-17(9-7-16)26-12-10-25(5)11-13-26/h6-9,14H,10-13H2,1-5H3,(H2,21,22,23,24) |
| InChIKey | UEZBHUBAJYOEHX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|