C23H23N9 — CID 67408968
9-(1H-indazol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-2-amine (PubChem CID 67408968) has the molecular formula C23H23N9 and a molecular weight of 425.50 g/mol. Its IUPAC name is 9-(1H-indazol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-2-amine.
| Compound Name | 9-(1H-indazol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-2-amine |
|---|---|
| PubChem CID | 67408968 |
| Molecular Formula | C23H23N9 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 9-(1H-indazol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ncn(-c5ccc6cn[nH]c6c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C23H23N9/c1-30-8-10-31(11-9-30)18-6-3-17(4-7-18)27-23-24-14-21-22(28-23)32(15-25-21)19-5-2-16-13-26-29-20(16)12-19/h2-7,12-15H,8-11H2,1H3,(H,26,29)(H,24,27,28) |
| InChIKey | VZIYSGKLIYISJS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|