C26H25N7 — CID 25000971
N-[4-(4-methylpiperazin-1-yl)phenyl]-1-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 25000971) has the molecular formula C26H25N7 and a molecular weight of 435.54 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-1-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-1-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 25000971 |
| Molecular Formula | C26H25N7 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-1-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cnn(-c5ccc6ccccc6c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C26H25N7/c1-31-12-14-32(15-13-31)23-10-7-22(8-11-23)29-26-27-17-21-18-28-33(25(21)30-26)24-9-6-19-4-2-3-5-20(19)16-24/h2-11,16-18H,12-15H2,1H3,(H,27,29,30) |
| InChIKey | WRNQONBRKRYHAA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|