C26H28N8 — CID 171729602
1-(1-ethylindol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 171729602) has the molecular formula C26H28N8 and a molecular weight of 452.57 g/mol. Its IUPAC name is 1-(1-ethylindol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-(1-ethylindol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 171729602 |
| Molecular Formula | C26H28N8 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 1-(1-ethylindol-6-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CCn1ccc2ccc(-n3ncc4cnc(Nc5ccc(N6CCN(C)CC6)cc5)nc43)cc21 |
| InChI | InChI=1S/C26H28N8/c1-3-32-11-10-19-4-7-23(16-24(19)32)34-25-20(18-28-34)17-27-26(30-25)29-21-5-8-22(9-6-21)33-14-12-31(2)13-15-33/h4-11,16-18H,3,12-15H2,1-2H3,(H,27,29,30) |
| InChIKey | QXDQRPWYBXEENC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|