C30H32N8O — CID 70934528
8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1-methylpyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70934528) has the molecular formula C30H32N8O and a molecular weight of 520.64 g/mol. Its IUPAC name is 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1-methylpyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1-methylpyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70934528 |
| Molecular Formula | C30H32N8O |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1-methylpyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cnn(C)c3)cc2)cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C30H32N8O/c1-4-38-28-23(17-27(29(38)39)22-7-5-21(6-8-22)24-19-32-36(3)20-24)18-31-30(34-28)33-25-9-11-26(12-10-25)37-15-13-35(2)14-16-37/h5-12,17-20H,4,13-16H2,1-3H3,(H,31,33,34) |
| InChIKey | CQUZKCSOUWUDDB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|