C29H38N8OS — CID 123648115
8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(1-methyl-4-piperidin-4-yl-4H-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 123648115) has the molecular formula C29H38N8OS and a molecular weight of 546.75 g/mol. Its IUPAC name is 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(1-methyl-4-piperidin-4-yl-4H-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(1-methyl-4-piperidin-4-yl-4H-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 123648115 |
| Molecular Formula | C29H38N8OS |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(1-methyl-4-piperidin-4-yl-4H-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(C2=NC(C3CCNCC3)C=S2C)cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C29H38N8OS/c1-4-37-26-21(17-24(28(37)38)27-33-25(19-39(27)3)20-9-11-30-12-10-20)18-31-29(34-26)32-22-5-7-23(8-6-22)36-15-13-35(2)14-16-36/h5-8,17-20,25,30H,4,9-16H2,1-3H3,(H,31,32,34) |
| InChIKey | JJLGFBBMDNOMNT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|