C29H30N8O — CID 70934521
8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1H-pyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70934521) has the molecular formula C29H30N8O and a molecular weight of 506.61 g/mol. Its IUPAC name is 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1H-pyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1H-pyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70934521 |
| Molecular Formula | C29H30N8O |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-[4-(1H-pyrazol-4-yl)phenyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cn[nH]c3)cc2)cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C29H30N8O/c1-3-37-27-22(16-26(28(37)38)21-6-4-20(5-7-21)23-18-31-32-19-23)17-30-29(34-27)33-24-8-10-25(11-9-24)36-14-12-35(2)13-15-36/h4-11,16-19H,3,12-15H2,1-2H3,(H,31,32)(H,30,33,34) |
| InChIKey | GBNZBWDZGPQPOD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|