C31H32N6O — CID 70934165
6-(4-cyclopenta-1,3-dien-1-ylphenyl)-8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70934165) has the molecular formula C31H32N6O and a molecular weight of 504.64 g/mol. Its IUPAC name is 6-(4-cyclopenta-1,3-dien-1-ylphenyl)-8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(4-cyclopenta-1,3-dien-1-ylphenyl)-8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70934165 |
| Molecular Formula | C31H32N6O |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 6-(4-cyclopenta-1,3-dien-1-ylphenyl)-8-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(C3=CC=CC3)cc2)cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C31H32N6O/c1-3-37-29-25(20-28(30(37)38)24-10-8-23(9-11-24)22-6-4-5-7-22)21-32-31(34-29)33-26-12-14-27(15-13-26)36-18-16-35(2)17-19-36/h4-6,8-15,20-21H,3,7,16-19H2,1-2H3,(H,32,33,34) |
| InChIKey | GRRHHDOBXXQDHJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|