C24H24N8O — CID 171729566
6-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroisoindol-1-one (PubChem CID 171729566) has the molecular formula C24H24N8O and a molecular weight of 440.51 g/mol. Its IUPAC name is 6-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 171729566 |
| Molecular Formula | C24H24N8O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 6-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroisoindol-1-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cnn(-c5ccc6c(c5)C(=O)NC6)c4n3)cc2)CC1 |
| InChI | InChI=1S/C24H24N8O/c1-30-8-10-31(11-9-30)19-6-3-18(4-7-19)28-24-26-14-17-15-27-32(22(17)29-24)20-5-2-16-13-25-23(33)21(16)12-20/h2-7,12,14-15H,8-11,13H2,1H3,(H,25,33)(H,26,28,29) |
| InChIKey | WJDXIJUGNHNSOT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|