C18H24N6 — CID 170324513
N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170324513) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170324513 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)CNCC4)cc2)CC1 |
| InChI | InChI=1S/C18H24N6/c1-23-8-10-24(11-9-23)16-4-2-15(3-5-16)21-18-20-12-14-6-7-19-13-17(14)22-18/h2-5,12,19H,6-11,13H2,1H3,(H,20,21,22) |
| InChIKey | ZYAWIUWTDOKCFQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|