C34H41N9O2 — CID 177363776
1-[2-methyl-4-[3-[7-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]azetidin-1-yl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 177363776) has the molecular formula C34H41N9O2 and a molecular weight of 607.76 g/mol. Its IUPAC name is 1-[2-methyl-4-[3-[7-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]azetidin-1-yl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-methyl-4-[3-[7-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]azetidin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177363776 |
| Molecular Formula | C34H41N9O2 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | 1-[2-methyl-4-[3-[7-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]azetidin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc(N2CC(N3CC4(CCN(c5ccc(Nc6ncc7c(n6)CNCC7)cc5)CC4)C3)C2)ccc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C34H41N9O2/c1-23-16-27(6-7-30(23)43-13-9-31(44)39-33(43)45)41-19-28(20-41)42-21-34(22-42)10-14-40(15-11-34)26-4-2-25(3-5-26)37-32-36-17-24-8-12-35-18-29(24)38-32/h2-7,16-17,28,35H,8-15,18-22H2,1H3,(H,36,37,38)(H,39,44,45) |
| InChIKey | CBLSOSCHIJFJEL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|