C35H42N10O2 — CID 177362763
1-[1-methyl-7-[4-[4-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]piperidin-1-yl]piperidin-1-yl]indazol-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 177362763) has the molecular formula C35H42N10O2 and a molecular weight of 634.79 g/mol. Its IUPAC name is 1-[1-methyl-7-[4-[4-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]piperidin-1-yl]piperidin-1-yl]indazol-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[1-methyl-7-[4-[4-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]piperidin-1-yl]piperidin-1-yl]indazol-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177362763 |
| Molecular Formula | C35H42N10O2 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | 1-[1-methyl-7-[4-[4-[4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-ylamino)phenyl]piperidin-1-yl]piperidin-1-yl]indazol-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | Cn1nc(N2CCC(=O)NC2=O)c2cccc(N3CCC(N4CCC(c5ccc(Nc6ncc7c(n6)CNCC7)cc5)CC4)CC3)c21 |
| InChI | InChI=1S/C35H42N10O2/c1-42-32-28(33(41-42)45-20-14-31(46)40-35(45)47)3-2-4-30(32)44-18-12-27(13-19-44)43-16-10-24(11-17-43)23-5-7-26(8-6-23)38-34-37-21-25-9-15-36-22-29(25)39-34/h2-8,21,24,27,36H,9-20,22H2,1H3,(H,37,38,39)(H,40,46,47) |
| InChIKey | GKQBOQMEQGEXFD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |