C18H21N5O3 — CID 172630164
1-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-7-yl]piperidine-4-carbaldehyde (PubChem CID 172630164) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-7-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-7-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 172630164 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-7-yl]piperidine-4-carbaldehyde |
| SMILES | Cn1nc(N2CCC(=O)NC2=O)c2cccc(N3CCC(C=O)CC3)c21 |
| InChI | InChI=1S/C18H21N5O3/c1-21-16-13(17(20-21)23-10-7-15(25)19-18(23)26)3-2-4-14(16)22-8-5-12(11-24)6-9-22/h2-4,11-12H,5-10H2,1H3,(H,19,25,26) |
| InChIKey | USHIENVYTGNAGI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|