C21H31N7O2 — CID 162529778
1-[7-[3-[(2R,6S)-2,6-dimethylpiperazin-1-yl]propylamino]-1-methylindazol-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 162529778) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 1-[7-[3-[(2R,6S)-2,6-dimethylpiperazin-1-yl]propylamino]-1-methylindazol-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[7-[3-[(2R,6S)-2,6-dimethylpiperazin-1-yl]propylamino]-1-methylindazol-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 162529778 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[7-[3-[(2R,6S)-2,6-dimethylpiperazin-1-yl]propylamino]-1-methylindazol-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C[C@@H]1CNC[C@H](C)N1CCCNc1cccc2c(N3CCC(=O)NC3=O)nn(C)c12 |
| InChI | InChI=1S/C21H31N7O2/c1-14-12-22-13-15(2)27(14)10-5-9-23-17-7-4-6-16-19(17)26(3)25-20(16)28-11-8-18(29)24-21(28)30/h4,6-7,14-15,22-23H,5,8-13H2,1-3H3,(H,24,29,30)/t14-,15+ |
| InChIKey | LONWMUCBVDUEEC-GASCZTMLSA-N |
| XLogP | 1.50 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|