C19H25N5O2 — CID 170629752
3-[1-methyl-7-[[(3R)-piperidin-3-yl]methylamino]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170629752) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[1-methyl-7-[[(3R)-piperidin-3-yl]methylamino]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[[(3R)-piperidin-3-yl]methylamino]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170629752 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-[1-methyl-7-[[(3R)-piperidin-3-yl]methylamino]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(NC[C@@H]3CCCNC3)c21 |
| InChI | InChI=1S/C19H25N5O2/c1-24-18-13(17(23-24)14-7-8-16(25)22-19(14)26)5-2-6-15(18)21-11-12-4-3-9-20-10-12/h2,5-6,12,14,20-21H,3-4,7-11H2,1H3,(H,22,25,26)/t12-,14?/m1/s1 |
| InChIKey | FLRWAKZDIQLHJE-PUODRLBUSA-N |
| XLogP | 1.50 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|